Question 1

Which acid would be expected to have the highest boiling point?

Accepted Answer

A) acetic,CH3CO2H 
B) benzoic,C6H5CO2H 
C) formic,HCO2H 
D) oxalic, (CO2H)2 
E) stearic,CH3(CH2)16 CO2H 
A) acetic,CH3CO2H 
B) benzoic,C6H5CO2H 
C) formic,HCO2H 
D) oxalic, (CO2H)2 
E) stearic,CH3(CH2)16 CO2H

Question 2

What are the products of this reaction?

Accepted Answer

A) 
  
B) 
  
C) 
  
D) 
  
A) 
  
B) 
  
C) 
  
D)

Question 3

Which of the following bonds is not present in a carboxylic acid functional group?

Accepted Answer

A) C=C 
B) C=O 
C) C-O 
D) O-H 
E) none of the above 
A) C=C 
B) C=O 
C) C-O 
D) O-H 
E) none of the above

Question 4

In the production of an ester,the carboxylic acid loses which atom or group of atoms?

Accepted Answer

A) oxygen from the C=O 
B) H from the OH group 
C) the OH group 
D) the entire COOH group 
E) oxygen from the OH 
A) oxygen from the C=O 
B) H from the OH group 
C) the OH group 
D) the entire COOH group 
E) oxygen from the OH

Question 5

Match the following.
-phosphate monoester

Accepted Answer

A) a molecule that contains one phosphate ester linkage and one phosphoric anhydride linkage 
B) a molecule that contains one phosphate ester linkage and two phosphoric anhydride linkages 
C) a polymer produced by reacting diamines with diacids or diacyl chlorides 
D) a functional group formed when two acid molecules give up one water molecule 
E) a functional group consisting of an amine group bonded to a carbonyl carbon
F)the type of ester produced when phosphoric acid reacts with two molecules of alcohol
G)a functional group consisting of a carbonyl carbon with a single bond to another oxygen; the remaining bonds are formed with R groups
H)the carbon atom bonded directly to the carbonyl carbon atom
I)the type of ester produced when phosphoric acid reacts with three molecules of alcohol
J)The common name of this compound is acetic acid.
K)the type of ester produced when phosphoric acid reacts with one molecule of alcohol
L)the transfer of a phosphoryl group from one molecule to another
M)The common name of this compound is formic acid. 
A) a molecule that contains one phosphate ester linkage and one phosphoric anhydride linkage 
B) a molecule that contains one phosphate ester linkage and two phosphoric anhydride linkages 
C) a polymer produced by reacting diamines with diacids or diacyl chlorides 
D) a functional group formed when two acid molecules give up one water molecule 
E) a functional group consisting of an amine group bonded to a carbonyl carbon
F)the type of ester produced when phosphoric acid reacts with two molecules of alcohol
G)a functional group consisting of a carbonyl carbon with a single bond to another oxygen; the remaining bonds are formed with R groups
H)the carbon atom bonded directly to the carbonyl carbon atom
I)the type of ester produced when phosphoric acid reacts with three molecules of alcohol
J)The common name of this compound is acetic acid.
K)the type of ester produced when phosphoric acid reacts with one molecule of alcohol
L)the transfer of a phosphoryl group from one molecule to another
M)The common name of this compound is formic acid.

Question 6

Match the following.
-triphosphate

Accepted Answer

A) a molecule that contains one phosphate ester linkage and one phosphoric anhydride linkage 
B) a molecule that contains one phosphate ester linkage and two phosphoric anhydride linkages 
C) a polymer produced by reacting diamines with diacids or diacyl chlorides 
D) a functional group formed when two acid molecules give up one water molecule 
E) a functional group consisting of an amine group bonded to a carbonyl carbon
F)the type of ester produced when phosphoric acid reacts with two molecules of alcohol
G)a functional group consisting of a carbonyl carbon with a single bond to another oxygen; the remaining bonds are formed with R groups
H)the carbon atom bonded directly to the carbonyl carbon atom
I)the type of ester produced when phosphoric acid reacts with three molecules of alcohol
J)The common name of this compound is acetic acid.
K)the type of ester produced when phosphoric acid reacts with one molecule of alcohol
L)the transfer of a phosphoryl group from one molecule to another
M)The common name of this compound is formic acid. 
A) a molecule that contains one phosphate ester linkage and one phosphoric anhydride linkage 
B) a molecule that contains one phosphate ester linkage and two phosphoric anhydride linkages 
C) a polymer produced by reacting diamines with diacids or diacyl chlorides 
D) a functional group formed when two acid molecules give up one water molecule 
E) a functional group consisting of an amine group bonded to a carbonyl carbon
F)the type of ester produced when phosphoric acid reacts with two molecules of alcohol
G)a functional group consisting of a carbonyl carbon with a single bond to another oxygen; the remaining bonds are formed with R groups
H)the carbon atom bonded directly to the carbonyl carbon atom
I)the type of ester produced when phosphoric acid reacts with three molecules of alcohol
J)The common name of this compound is acetic acid.
K)the type of ester produced when phosphoric acid reacts with one molecule of alcohol
L)the transfer of a phosphoryl group from one molecule to another
M)The common name of this compound is formic acid.

Question 7

Which acid would be expected to have the lowest boiling point?

Accepted Answer

A) acetic 
B) benzoic 
C) formic 
D) oxalic 
E) stearic 
A) acetic 
B) benzoic 
C) formic 
D) oxalic 
E) stearic

Question 8

What is the IUPAC name of the compound shown?

Accepted Answer

A) 2-methyl propanamide 
B) N-methyl propanamide 
C) 2-methyl butanamide 
D) 3-methyl butanamide 
E) N-methyl butanamide 
A) 2-methyl propanamide 
B) N-methyl propanamide 
C) 2-methyl butanamide 
D) 3-methyl butanamide 
E) N-methyl butanamide

Question 9

Match the following.
-methanoic acid

Accepted Answer

A) a molecule that contains one phosphate ester linkage and one phosphoric anhydride linkage 
B) a molecule that contains one phosphate ester linkage and two phosphoric anhydride linkages 
C) a polymer produced by reacting diamines with diacids or diacyl chlorides 
D) a functional group formed when two acid molecules give up one water molecule 
E) a functional group consisting of an amine group bonded to a carbonyl carbon
F)the type of ester produced when phosphoric acid reacts with two molecules of alcohol
G)a functional group consisting of a carbonyl carbon with a single bond to another oxygen; the remaining bonds are formed with R groups
H)the carbon atom bonded directly to the carbonyl carbon atom
I)the type of ester produced when phosphoric acid reacts with three molecules of alcohol
J)The common name of this compound is acetic acid.
K)the type of ester produced when phosphoric acid reacts with one molecule of alcohol
L)the transfer of a phosphoryl group from one molecule to another
M)The common name of this compound is formic acid. 
A) a molecule that contains one phosphate ester linkage and one phosphoric anhydride linkage 
B) a molecule that contains one phosphate ester linkage and two phosphoric anhydride linkages 
C) a polymer produced by reacting diamines with diacids or diacyl chlorides 
D) a functional group formed when two acid molecules give up one water molecule 
E) a functional group consisting of an amine group bonded to a carbonyl carbon
F)the type of ester produced when phosphoric acid reacts with two molecules of alcohol
G)a functional group consisting of a carbonyl carbon with a single bond to another oxygen; the remaining bonds are formed with R groups
H)the carbon atom bonded directly to the carbonyl carbon atom
I)the type of ester produced when phosphoric acid reacts with three molecules of alcohol
J)The common name of this compound is acetic acid.
K)the type of ester produced when phosphoric acid reacts with one molecule of alcohol
L)the transfer of a phosphoryl group from one molecule to another
M)The common name of this compound is formic acid.

Question 10

When an amide is hydrolyzed under basic conditions,the products are

Accepted Answer

A) an amine and a carboxylic acid. 
B) an amine and a carboxylate ion. 
C) an ammonium ion and a carboxylate ion. 
D) an ammonium ion and a carboxylic acid. 
E) There is no reaction. 
A) an amine and a carboxylic acid. 
B) an amine and a carboxylate ion. 
C) an ammonium ion and a carboxylate ion. 
D) an ammonium ion and a carboxylic acid. 
E) There is no reaction.

Question 11

Which formula correctly illustrates the form which acetic acid would take in a basic solution?

Accepted Answer

A) 
  
B) 
  
C) 
  
D) 
  
E) 
  
A) 
  
B) 
  
C) 
  
D) 
  
E)

Question 12

Nylons and proteins are both referred to as polyamides because

Accepted Answer

A) each reactant molecule contains an amide group. 
B) they are produced by reaction between an amide and an ester. 
C) they are formed when an acid reacts with ammonia. 
D) they are produced by basic hydrolysis of an amine. 
E) they are formed when an acid functional group reacts with an amine functional group. 
A) each reactant molecule contains an amide group. 
B) they are produced by reaction between an amide and an ester. 
C) they are formed when an acid reacts with ammonia. 
D) they are produced by basic hydrolysis of an amine. 
E) they are formed when an acid functional group reacts with an amine functional group.

Question 13

Reaction of an ester with a strong base is called

Accepted Answer

A) reverse esterification. 
B) esterification. 
C) saponification. 
D) oxidation. 
E) condensation. 
A) reverse esterification. 
B) esterification. 
C) saponification. 
D) oxidation. 
E) condensation.

Question 14

What is the major organic product of the reaction shown?

Accepted Answer

A) 
  
B) 
  
C) 
  
D) 
  
E) 
CH3CH2CH2CH2OCH2OCH(CH3)2 
A) 
  
B) 
  
C) 
  
D) 
  
E) 
CH3CH2CH2CH2OCH2OCH(CH3)2

Question 15

Which molecule is an ester?

Accepted Answer

A) 
  
B) 
  
C) 
  
D) 
  
E) CH3CH2CH2NH2 
A) 
  
B) 
  
C) 
  
D) 
  
E) CH3CH2CH2NH2

Question 16

An alpha hydroxy carboxylic acid has an additional -OH group attached to the molecule at which location?

Accepted Answer

A) the carbonyl carbon atom 
B) the #2 carbon atom 
C) the carbon atom farthest from the carboxyl group 
D) the carbon atom that contains the amine group 
E) none of the above 
A) the carbonyl carbon atom 
B) the #2 carbon atom 
C) the carbon atom farthest from the carboxyl group 
D) the carbon atom that contains the amine group 
E) none of the above

Question 17

Which of the following conditions would favor the carboxylate ion form of a carboxylic acid?

Accepted Answer

A) low pH 
B) high pH 
C) both A and B 
D) neither A nor B 
A) low pH 
B) high pH 
C) both A and B 
D) neither A nor B

Question 18

What is the IUPAC name of the compound shown?
CH3CH2COOCH3

Accepted Answer

A) 2-butanoic acid 
B) 3-butanoic acid 
C) methyl ethanoate 
D) propyl methanoate 
E) methyl propanoate 
A) 2-butanoic acid 
B) 3-butanoic acid 
C) methyl ethanoate 
D) propyl methanoate 
E) methyl propanoate

Question 19

What is the common name of the molecule shown?

Accepted Answer

A) γ-amino-α-hydroxybutyric acid 
B) 4-amino-2-hydroxybutanoic acid 
C) α-amino-γ-hydroxybutyric acid 
D) 1-amino-3-hydroxybutanoic acid 
E) none of these 
A) γ-amino-α-hydroxybutyric acid 
B) 4-amino-2-hydroxybutanoic acid 
C) α-amino-γ-hydroxybutyric acid 
D) 1-amino-3-hydroxybutanoic acid 
E) none of these

Question 20

When an amine reacts with a carboxylic acid at high temperature the major product is

Accepted Answer

A) an ester. 
B) an amide. 
C) a thiol. 
D) an ether. 
E) an alcohol. 
A) an ester. 
B) an amide. 
C) a thiol. 
D) an ether. 
E) an alcohol.

Exam 17: Carboxylic Acids and Their Derivatives

Which acid would be expected to have the highest boiling point?

What are the products of this reaction?

Which of the following bonds is not present in a carboxylic acid functional group?

In the production of an ester,the carboxylic acid loses which atom or group of atoms?

Match the following. -phosphate monoester

Match the following. -triphosphate

Which acid would be expected to have the lowest boiling point?

What is the IUPAC name of the compound shown?

Match the following. -methanoic acid

When an amide is hydrolyzed under basic conditions,the products are

Which formula correctly illustrates the form which acetic acid would take in a basic solution?

Nylons and proteins are both referred to as polyamides because

Reaction of an ester with a strong base is called

What is the major organic product of the reaction shown?

Which molecule is an ester?

An alpha hydroxy carboxylic acid has an additional -OH group attached to the molecule at which location?

Which of the following conditions would favor the carboxylate ion form of a carboxylic acid?

What is the IUPAC name of the compound shown? CH3CH2COOCH3

What is the common name of the molecule shown?

When an amine reacts with a carboxylic acid at high temperature the major product is

Matter and Measurements

Atoms and the Periodic Table

Ionic Compounds

Molecular Compounds

Classification and Balancing of Chemical Reactions

Chemical Reactions: Mole and Mass Relationships

Chemical Reactions: Energy, rates, and Equilibrium

Gases, liquids, and Solids

Solutions

Acids and Bases

Nuclear Chemistry

Introduction to Organic Chemistry: Alkanes

Alkenes, alkynes, and Aromatic Compounds

Some Compounds With Oxygen, sulfur, or a Halogen

Amines

Aldehydes and Ketones

Amino Acids and Proteins

Enzymes and Vitamins

The Generation of Biochemical Energy

Carbohydrates

Carbohydrate Metabolism

Lipids

Lipid Metabolism

Nucleic Acids and Protein Synthesis

Genomics

Protein and Amino Acid Metabolism

Chemical Messengers: Hormones, neurotransmitters, and Drugs

Body Fluids

Filters

What is the IUPAC name of the compound shown? CH₃CH₂COOCH₃