Question 1

For the reaction
N2O4(g) $f$
2NO2(g)
Which of the following disturbances will cause an increase in NO2(g)
Concentration?

Accepted Answer

A)  a decrease in temperature 
B)  need to know F1F1F1S1?F1F1F10H for the reaction to predict 
C)  removal of some N2O4(g) 
D)  an increase in pressure 
E)  an increase in temperature 
A)  a decrease in temperature 
B)  need to know F1F1F1S1?F1F1F10H for the reaction to predict 
C)  removal of some N2O4(g) 
D)  an increase in pressure 
E)  an increase in temperature

Question 2

For a pure solid or liquid,the molar free energy always has its standard value

Accepted Answer

A) True 
 B)False

Question 3

Solutions in which intermolecular forces are stronger in the solution than in the pure components have negative enthalpies of mixing.

Accepted Answer

A) True 
 B)False

Question 4

At 700 K, K = 54 for the reaction
H2(g)+ I2(g) $f$
2HI(g)
Calculate Kc at 700 K for this reaction.

Accepted Answer

A)  3.2 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F104  
B)  0.94 
C)  7.7 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F104  
D)  0.45 
E)  54 
A)  3.2 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F104  
B)  0.94 
C)  7.7 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F104  
D)  0.45 
E)  54

Question 5

Which of the following pairs have a vant Hoff i factor of 3?

Accepted Answer

A)  Sodium sulfate and potassium chloride 
B)  Calcium chloride and potassium sulfate 
C)  Magnesium sulfate and ethylene glycol 
D)  Glucose and sodium chloride 
E)  Perchloric acid and barium hydroxide 
A)  Sodium sulfate and potassium chloride 
B)  Calcium chloride and potassium sulfate 
C)  Magnesium sulfate and ethylene glycol 
D)  Glucose and sodium chloride 
E)  Perchloric acid and barium hydroxide

Question 6

What relationship does the vapor pressure of a mixture have to that of a pure liquid?

Accepted Answer

A)  It increases with increasing mass of solute added to the mixture. 
B)  It is proportional to the mole fraction of the liquid. 
C)  The liquid will always have a lower vapor pressure than the mixture. 
D)  There is no direct correlation without also knowing the temperature. 
A)  It increases with increasing mass of solute added to the mixture. 
B)  It is proportional to the mole fraction of the liquid. 
C)  The liquid will always have a lower vapor pressure than the mixture. 
D)  There is no direct correlation without also knowing the temperature.

Question 7

Calculate the standard free energy of formation of chloroform,
CHCl3(l),at 25°C.The standard free energy of formation of CHCl3(g)
is F1F1F1S1-F1F1F1070.12 kJF1F1F1S1.F1F1F10molF1F1F1S1-F1F1F101 and the vapor pressure of chloroform at 25°C is 0.499 atm.

Accepted Answer

F1F1F1S1?F1F1F1071.8

Question 8

The phase diagram for carbon dioxide is given below.   If the triple point is at 5.1 atm and F1F1F1S1F1F1F1056F1F1F1S1F1F1F10C,
At 1 atm and room temperature

Accepted Answer

A)  solid carbon dioxide is the stable phase. 
B)  liquid carbon dioxide is the stable phase. 
C)  gaseous carbon dioxide condenses. 
D)  gaseous carbon dioxide is the stable phase. 
E)  solid carbon dioxide melts. 
A)  solid carbon dioxide is the stable phase. 
B)  liquid carbon dioxide is the stable phase. 
C)  gaseous carbon dioxide condenses. 
D)  gaseous carbon dioxide is the stable phase. 
E)  solid carbon dioxide melts.

Question 9

The vapor pressure of methanol at 25$\omicron$C is 123 Torr and its enthalpy of vaporization is 35.3 kJF1F1F1S1.F1F1F10molF1F1F1S1-F1F1F101 . Estimate the normal boiling point of methanol.Assume the enthalpy of vaporization is independent of temperature.

Accepted Answer

A)  450 K 
B)  342 K 
C)  315 K 
D)  373 K 
E)  Not enough information given. 
A)  450 K 
B)  342 K 
C)  315 K 
D)  373 K 
E)  Not enough information given.

Question 10

For the reaction
NH3(g)+ H2S(g) $f$
NH4HS(s)
Kc = 9.7 at 900 K.If the initial concentrations of NH3(g)And H2S(g)Are 2.0 M,What is the equilibrium concentration of H2S(g)?

Accepted Answer

A)  1.9 M 
B)  0.20 M 
C)  1.7 M 
D)  0.10 M 
E)  0.32 M 
A)  1.9 M 
B)  0.20 M 
C)  1.7 M 
D)  0.10 M 
E)  0.32 M

Question 11

Water and acetone,CH3COCH3,both freeze at a higher temperature under pressure.

Accepted Answer

A) True 
 B)False

Question 12

Consider the reaction
2Fe2O3(s)+ 3C(s)$\rightarrow$ 4Fe(s)+ 3CO2(g),
$\Delta$H$\omicron$ = 462 kJ,
$\Delta$S$\omicron$ = 558 JF1F1F1S1.F1F1F10KF1F1F1S1-F1F1F101
Calculate the equilibrium constant for this reaction at 525$\omicron$C.

Accepted Answer

A)  3.04 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F103  
B)  8.07 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F102  
C)  5.20 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F107  
D)  1.9 F1F1F1S1*F1F1F10 106  
E)  2.18 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F102  
A)  3.04 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F103  
B)  8.07 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F102  
C)  5.20 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F107  
D)  1.9 F1F1F1S1*F1F1F10 106  
E)  2.18 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F102

Question 13

What is the relationship between K and Kc for the reaction below?
NH4(NH2CO2)(s)$f$2NH3(g)+ CO2(g)

Accepted Answer

A)  Kc = (RT)2K 
B)  K = RTKc  
C)  K = (RT)2Kc  
D)  K = (RT)3Kc  
E)  Kc = (RT)3K 
A)  Kc = (RT)2K 
B)  K = RTKc  
C)  K = (RT)2Kc  
D)  K = (RT)3Kc  
E)  Kc = (RT)3K

Question 14

If a reaction mixture that is not at equilibrium contains more products than reactants,$\Delta$G > 0 for the forward reaction

Accepted Answer

A) True 
 B)False

Question 15

If you wanted to study solutions of different concentrations at different temperatures,would you use molarity or molality as your measure of concentration? Why?

Accepted Answer

molality,b

Question 16

Consider the following reaction at a certain temperature:
2HI(g)
$f$
H2(g)+ I2(g)
K = 0.420
If 2.0 mol of H2(g)And I2(g),And 0.10 mol HI(g)Were mixed in a 1.0-L flask,Then

Accepted Answer

A)  the concentration of I2(g) would increase. 
B)  the value of K would increase to 400. 
C)  the concentration of HI(g) would increase. 
D)  no change would occur. 
E)  the total number of molecules would decrease. 
A)  the concentration of I2(g) would increase. 
B)  the value of K would increase to 400. 
C)  the concentration of HI(g) would increase. 
D)  no change would occur. 
E)  the total number of molecules would decrease.

Question 17

At equilibrium, Q = K and $\Delta$G°r = 0.

Accepted Answer

A) True 
 B)False

Question 18

Which of the following pairs have a vant Hoff i factor of 2?

Accepted Answer

A)  Sodium sulfate and potassium chloride 
B)  Sodium chloride and magnesium sulfate 
C)  Magnesium sulfate and ethylene glycol 
D)  Glucose and sodium chloride 
E)  Perchloric acid and barium hydroxide 
A)  Sodium sulfate and potassium chloride 
B)  Sodium chloride and magnesium sulfate 
C)  Magnesium sulfate and ethylene glycol 
D)  Glucose and sodium chloride 
E)  Perchloric acid and barium hydroxide

Question 19

For a one-component system, at the triple point

Accepted Answer

A)  f = 3. 
B)  f = 2. 
C)  p = 1. 
D)  f = 0. 
E)  f = 1. 
A)  f = 3. 
B)  f = 2. 
C)  p = 1. 
D)  f = 0. 
E)  f = 1.

Question 20

If $\Delta$Gro = 27.1 kJ.molF1F1F1S1-F1F1F101 at 25$\omicron$C for the dissociation of acetic acid in aqueous solution,what is K for the reaction
CH3COOF1F1F1S1-F1F1F10(aq)+ H3O+(aq) $f$ 
CH3COOH(aq)+ H2O(l)

Accepted Answer

5.63 F1F1F

For the reaction N₂O₄(g) $f$ 2NO₂(g) Which of the following disturbances will cause an increase in NO₂(g) Concentration?

For a pure solid or liquid,the molar free energy always has its standard value

Solutions in which intermolecular forces are stronger in the solution than in the pure components have negative enthalpies of mixing.

At 700 K, K = 54 for the reaction H₂(g)+ I₂(g) $f$ 2HI(g) Calculate K_c at 700 K for this reaction.

Which of the following pairs have a vant Hoff i factor of 3?

What relationship does the vapor pressure of a mixture have to that of a pure liquid?

Calculate the standard free energy of formation of chloroform, CHCl₃(l),at 25°C.The standard free energy of formation of CHCl₃(g) is -70.12 kJ.mol^-¹ and the vapor pressure of chloroform at 25°C is 0.499 atm.

The phase diagram for carbon dioxide is given below. If the triple point is at 5.1 atm and 56C, At 1 atm and room temperature

The vapor pressure of methanol at 25^$\omicron$C is 123 Torr and its enthalpy of vaporization is 35.3 kJ.mol^-¹ . Estimate the normal boiling point of methanol.Assume the enthalpy of vaporization is independent of temperature.

For the reaction NH₃(g)+ H₂S(g) $f$ NH₄HS(s) K_c = 9.7 at 900 K.If the initial concentrations of NH₃(g)And H₂S(g)Are 2.0 M,What is the equilibrium concentration of H₂S(g)?

Water and acetone,CH₃COCH₃,both freeze at a higher temperature under pressure.

Consider the reaction 2Fe₂O₃(s)+ 3C(s) $\rightarrow$ 4Fe(s)+ 3CO₂(g), $\Delta$ H^$\omicron$= 462 kJ, $\Delta$ S^$\omicron$= 558 J.K^-¹ Calculate the equilibrium constant for this reaction at 525^$\omicron$C.

What is the relationship between K and K_c for the reaction below? NH₄(NH₂CO₂)(s) $f$ 2NH₃(g)+ CO₂(g)

If a reaction mixture that is not at equilibrium contains more products than reactants, $\Delta$ G > 0 for the forward reaction

If you wanted to study solutions of different concentrations at different temperatures,would you use molarity or molality as your measure of concentration? Why?

Consider the following reaction at a certain temperature: 2HI(g) $f$ H₂(g)+ I₂(g) K = 0.420 If 2.0 mol of H₂(g)And I₂(g),And 0.10 mol HI(g)Were mixed in a 1.0-L flask,Then

At equilibrium, Q = K and $\Delta$ G°_r = 0.

Which of the following pairs have a vant Hoff i factor of 2?

For a one-component system, at the triple point

If $\Delta$ G_r^o = 27.1 kJ.mol^-¹ at 25^$\omicron$C for the dissociation of acetic acid in aqueous solution,what is K for the reaction CH₃COO^-(aq)+ H₃O⁺(aq) $f$ CH₃COOH(aq)+ H₂O(l)

Atoms

Molecules

States of Matter

Thermodynamics

Reactions

Kinetics

The Main-Group Elements

The D-Block Elements

Nuclear Chemistry

Organic Chemistry

Filters

Exam 5: Equilibrium

For the reaction N2O4(g) fff 2NO2(g) Which of the following disturbances will cause an increase in NO2(g) Concentration?

For a pure solid or liquid,the molar free energy always has its standard value

Solutions in which intermolecular forces are stronger in the solution than in the pure components have negative enthalpies of mixing.

At 700 K, K = 54 for the reaction H2(g)+ I2(g) fff 2HI(g) Calculate Kc at 700 K for this reaction.

Which of the following pairs have a vant Hoff i factor of 3?

What relationship does the vapor pressure of a mixture have to that of a pure liquid?

Calculate the standard free energy of formation of chloroform, CHCl3(l),at 25°C.The standard free energy of formation of CHCl3(g) is -70.12 kJ.mol-1 and the vapor pressure of chloroform at 25°C is 0.499 atm.

The phase diagram for carbon dioxide is given below. If the triple point is at 5.1 atm and 56C, At 1 atm and room temperature

The vapor pressure of methanol at 25 ο\omicronο C is 123 Torr and its enthalpy of vaporization is 35.3 kJ.mol-1 . Estimate the normal boiling point of methanol.Assume the enthalpy of vaporization is independent of temperature.

For the reaction NH3(g)+ H2S(g) fff NH4HS(s) Kc = 9.7 at 900 K.If the initial concentrations of NH3(g)And H2S(g)Are 2.0 M,What is the equilibrium concentration of H2S(g)?

Water and acetone,CH3COCH3,both freeze at a higher temperature under pressure.

Consider the reaction 2Fe2O3(s)+ 3C(s) →\rightarrow→ 4Fe(s)+ 3CO2(g), Δ\DeltaΔ H ο\omicronο = 462 kJ, Δ\DeltaΔ S ο\omicronο = 558 J.K-1 Calculate the equilibrium constant for this reaction at 525 ο\omicronο C.

What is the relationship between K and Kc for the reaction below? NH4(NH2CO2)(s) fff 2NH3(g)+ CO2(g)

If a reaction mixture that is not at equilibrium contains more products than reactants, Δ\DeltaΔ G > 0 for the forward reaction

If you wanted to study solutions of different concentrations at different temperatures,would you use molarity or molality as your measure of concentration? Why?

Consider the following reaction at a certain temperature: 2HI(g) fff H2(g)+ I2(g) K = 0.420 If 2.0 mol of H2(g)And I2(g),And 0.10 mol HI(g)Were mixed in a 1.0-L flask,Then

At equilibrium, Q = K and Δ\DeltaΔ G°r = 0.

Which of the following pairs have a vant Hoff i factor of 2?

For a one-component system, at the triple point

If Δ\DeltaΔ Gro = 27.1 kJ.mol-1 at 25 ο\omicronο C for the dissociation of acetic acid in aqueous solution,what is K for the reaction CH3COO-(aq)+ H3O+(aq) fff CH3COOH(aq)+ H2O(l)

Atoms

Molecules

States of Matter

Thermodynamics

Reactions

Kinetics

The Main-Group Elements

The D-Block Elements

Nuclear Chemistry

Organic Chemistry

Filters

For the reaction N₂O₄(g) $f$ 2NO₂(g) Which of the following disturbances will cause an increase in NO₂(g) Concentration?

At 700 K, K = 54 for the reaction H₂(g)+ I₂(g) $f$ 2HI(g) Calculate K_c at 700 K for this reaction.

Calculate the standard free energy of formation of chloroform, CHCl₃(l),at 25°C.The standard free energy of formation of CHCl₃(g) is -70.12 kJ.mol^-¹ and the vapor pressure of chloroform at 25°C is 0.499 atm.

The vapor pressure of methanol at 25^$\omicron$C is 123 Torr and its enthalpy of vaporization is 35.3 kJ.mol^-¹ . Estimate the normal boiling point of methanol.Assume the enthalpy of vaporization is independent of temperature.

For the reaction NH₃(g)+ H₂S(g) $f$ NH₄HS(s) K_c = 9.7 at 900 K.If the initial concentrations of NH₃(g)And H₂S(g)Are 2.0 M,What is the equilibrium concentration of H₂S(g)?

Water and acetone,CH₃COCH₃,both freeze at a higher temperature under pressure.

Consider the reaction 2Fe₂O₃(s)+ 3C(s) $\rightarrow$ 4Fe(s)+ 3CO₂(g), $\Delta$ H^$\omicron$= 462 kJ, $\Delta$ S^$\omicron$= 558 J.K^-¹ Calculate the equilibrium constant for this reaction at 525^$\omicron$C.

What is the relationship between K and K_c for the reaction below? NH₄(NH₂CO₂)(s) $f$ 2NH₃(g)+ CO₂(g)

If a reaction mixture that is not at equilibrium contains more products than reactants, $\Delta$ G > 0 for the forward reaction

Consider the following reaction at a certain temperature: 2HI(g) $f$ H₂(g)+ I₂(g) K = 0.420 If 2.0 mol of H₂(g)And I₂(g),And 0.10 mol HI(g)Were mixed in a 1.0-L flask,Then

At equilibrium, Q = K and $\Delta$ G°_r = 0.

If $\Delta$ G_r^o = 27.1 kJ.mol^-¹ at 25^$\omicron$C for the dissociation of acetic acid in aqueous solution,what is K for the reaction CH₃COO^-(aq)+ H₃O⁺(aq) $f$ CH₃COOH(aq)+ H₂O(l)