Question 1

Write the equilibrium constant for
2NaBr(aq)+Pb(ClO4)2(aq)
 $f$
PbBr2(s)+ 2NaClO4(aq).

Accepted Answer

A)  K = [Pb2+][BrF1F1F1S1?F1F1F10]2  
B)  K = 1/([Pb2+][BrF1F1F1S1?F1F1F10]2) 
C)  K = [NaClO4]2/([NaBr]2[Pb(ClO4)2] 
D)  K = [PbBr2]/([Pb2+][BrF1F1F1S1?F1F1F10]2) 
E)  K = 1/([Pb(ClO4)2][NaBr]2) 
A)  K = [Pb2+][BrF1F1F1S1?F1F1F10]2  
B)  K = 1/([Pb2+][BrF1F1F1S1?F1F1F10]2) 
C)  K = [NaClO4]2/([NaBr]2[Pb(ClO4)2] 
D)  K = [PbBr2]/([Pb2+][BrF1F1F1S1?F1F1F10]2) 
E)  K = 1/([Pb(ClO4)2][NaBr]2)

Question 2

Given: 2SO2(g) + O2(g) $f$
2SO3(g)
At equilibrium at a certain temperature,The concentrations of SO3(g),SO2(g),And O2(g)Are 0.24 M,0.82 M,
And 0.33 M,Respectively.
Calculate the value of Kc for this reaction.

Accepted Answer

A)  0.89 
B)  0.21 
C)  0.79 
D)  0.26 
E)  1.04 
A)  0.89 
B)  0.21 
C)  0.79 
D)  0.26 
E)  1.04

Question 3

If the equilibrium constant for the reaction Ni(s)+ 4CO(g) $f$ 
Ni(CO)4(g)is 2.72 at a certain temperature,what is the equilibrium constant for the following reaction at the same temperature?
Ni(CO)4(g) $f$ 
Ni(s)+ 4CO(g)

Accepted Answer

Question 4

The equilibrium constant, K,For the reaction
2HgO(s) $f$
2Hg(l)+ O2(g)
Is 1.2 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1030.Calculate K for the reaction
1/2O2(g)+ Hg(l) 
$f$
HgO(s).

Accepted Answer

A)  F1F1F1S1-F1F1F101.1 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1015  
B)  8.3 F1F1F1S1*F1F1F10 1029  
C)  4.2 F1F1F1S1*F1F1F10 1029  
D)  9.1 F1F1F1S1*F1F1F10 1014  
E)  1.1 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1015  
A)  F1F1F1S1-F1F1F101.1 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1015  
B)  8.3 F1F1F1S1*F1F1F10 1029  
C)  4.2 F1F1F1S1*F1F1F10 1029  
D)  9.1 F1F1F1S1*F1F1F10 1014  
E)  1.1 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1015

Question 5

Calculate the number of moles of oxygen that will dissolve in 45 L of water at 20$\omicron$C if the partial pressure of oxygen is 0.21 atm .Henry's constant for oxygen is 0.0013 molF1F1F1S1.F1F1F10LF1F1F1S1-F1F1F101F1F1F1S1.F1F1F10atmF1F1F1S1-F1F1F101.

Accepted Answer

A)  0.0062 M 
B)  0.0013 M 
C)  0.012 M 
D)  0.00027 M 
E)  0.28 
A)  0.0062 M 
B)  0.0013 M 
C)  0.012 M 
D)  0.00027 M 
E)  0.28

Question 6

Which of the following liquids freeze at a lower temperature when pressure is applied?

Accepted Answer

A)  Water 
B)  Acetic acid 
C)  Benzene 
D)  Methanol 
E)  Carbon tetrachloride 
A)  Water 
B)  Acetic acid 
C)  Benzene 
D)  Methanol 
E)  Carbon tetrachloride

Question 7

The phase diagram for CO2 is given below .
The triple point is at 5.1 atm and 217 K.  
What happens if carbon dioxide at F1F1F1S1F1F1F1050F1F1F1S1F1F1F10C and 25 atm is suddenly brought to 1 atm?

Accepted Answer

A)  The liquid and solid are in equilibrium. 
B)  The solid melts. 
C)  The solid and vapor are in equilibrium. 
D)  The solid vaporizes. 
E)  The solid remains stable. 
A)  The liquid and solid are in equilibrium. 
B)  The solid melts. 
C)  The solid and vapor are in equilibrium. 
D)  The solid vaporizes. 
E)  The solid remains stable.

Question 8

Calculate the vapor pressure of ethyl alcohol, C2H5OH(l),
At 298 K.The standard free energies of formation of C2H5OH(l)
And C2H5OH(g)Are F1F1F1S1-F1F1F10174.8 and F1F1F1S1-F1F1F10168.6 kJF1F1F1S1.F1F1F10molF1F1F1S1-F1F1F101,Respectively.

Accepted Answer

A)  0.082 atm 
B)  0.92 atm 
C)  0.0032 atm 
D)  1.0 atm 
E)  Not enough information given to permit the calculation. 
A)  0.082 atm 
B)  0.92 atm 
C)  0.0032 atm 
D)  1.0 atm 
E)  Not enough information given to permit the calculation.

Question 9

Blood, sweat,And tears are about 0.15 M in sodium chloride.Estimate the osmotic pressure of these solutions at 37$\omicron$C.The gas constant is 0.0821 LF1F1F1S1.F1F1F10atmF1F1F1S1.F1F1F10molF1F1F1S1-F1F1F101F1F1F1S1.F1F1F10KF1F1F1S1-F1F1F101.

Accepted Answer

A)  3.8 atm 
B)  11 atm 
C)  0.91 atm 
D)  1.8 atm 
E)  7.6 atm 
A)  3.8 atm 
B)  11 atm 
C)  0.91 atm 
D)  1.8 atm 
E)  7.6 atm

Question 10

For CaCl2, the absolute value of the enthalpy of hydration is larger than the lattice enthalpy.This means that for CaCl2

Accepted Answer

A)  the lattice enthalpy is negative. 
B)  the enthalpy of solution is endothermic. 
C)  the solubility increases when the temperature increases. 
D)  the enthalpy of hydration is positive. 
E)  the enthalpy of solution is exothermic. 
A)  the lattice enthalpy is negative. 
B)  the enthalpy of solution is endothermic. 
C)  the solubility increases when the temperature increases. 
D)  the enthalpy of hydration is positive. 
E)  the enthalpy of solution is exothermic.

Question 11

For the reaction
2CaSO4(s)
$f$
2CaO(s)+ 2SO2(g)+ O2(g)
K = 0.032 at 700 K.What is the total pressure starting from pure CaSO4(s)?

Accepted Answer

A)  0.22 bar 
B)  0.011 bar 
C)  0.60 bar 
D)  0.20 bar 
E)  0.40 bar 
A)  0.22 bar 
B)  0.011 bar 
C)  0.60 bar 
D)  0.20 bar 
E)  0.40 bar

Question 12

the van't Hoff i of HBr,HCl,and HF should all be the same?

Accepted Answer

A) True 
 B)False

Question 13

Which of the following has the lowest freezing point?

Accepted Answer

A)  2.0 m sodium perchlorate 
B)  1.0 m potassium phosphate 
C)  1.5 m aluminum nitrate 
D)  1.0 m aluminum sulfate 
E)  1.5 m magnesium phosphate 
A)  2.0 m sodium perchlorate 
B)  1.0 m potassium phosphate 
C)  1.5 m aluminum nitrate 
D)  1.0 m aluminum sulfate 
E)  1.5 m magnesium phosphate

Question 14

If $\Delta$G$\omicron$ = 27.1 kJ at 25$\omicron$C for the reactionCH3COOH(aq)+ H2O(l) $f$
CH3COOF1F1F1S1-F1F1F10(aq)+ H3O+(aq)What is Ka for this reaction at 298 K?

Accepted Answer

A)  1.15 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1011  
B)  5.63 F1F1F1S1*F1F1F10 104  
C)  1.78 F1F1F1S1?F1F1F10 10F1F1F1S1-F1F1F105  
D)  1.01 
E)  9.89 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F101  
A)  1.15 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F1011  
B)  5.63 F1F1F1S1*F1F1F10 104  
C)  1.78 F1F1F1S1?F1F1F10 10F1F1F1S1-F1F1F105  
D)  1.01 
E)  9.89 F1F1F1S1*F1F1F10 10F1F1F1S1-F1F1F101

Question 15

For the equilibrium CaCO3(s) $f$ CaO(s)+ CO2(g),
(a)represents the composition at equilibrium at a certain temperature.In (b),a small amount of Ca*CO3(s) has been added (Ca*CO3(s)represents Ca14CO3(s)or labeled calcium carbonate).Draw the composition in (c) at equilibrium and explain your drawing.

Accepted Answer

CaCO₃,Ca^*CO₃,CaO,and a

Question 16

At 25F1F1F1S1?F1F1F10C, K  = 6.9 F1F1F1S1*F1F1F10 105 for the reaction
N2(g)+ 3H2(g) $f$
2NH3(g)
Calculate Kc at 25F1F1F1S1?F1F1F10C for this reaction.

Accepted Answer

A)  2.8 F1F1F1S1*F1F1F10 104  
B)  6.8 F1F1F1S1*F1F1F10 105  
C)  1.1 F1F1F1S1*F1F1F10 103  
D)  1.7 F1F1F1S1*F1F1F10 107  
E)  4.1 F1F1F1S1*F1F1F10 108  
A)  2.8 F1F1F1S1*F1F1F10 104  
B)  6.8 F1F1F1S1*F1F1F10 105  
C)  1.1 F1F1F1S1*F1F1F10 103  
D)  1.7 F1F1F1S1*F1F1F10 107  
E)  4.1 F1F1F1S1*F1F1F10 108

Question 17

Consider the reaction
2SO2(g)+O2(g)$\rightarrow$ 2SO3(g)
At equilibrium at a certain temperature,the partial pressures of SO2(g),O2(g),
and SO3(g)are 0.0012,0.18,and 2.2 bar,respectively.Argon is introduced into the reaction vessel until the partial pressure of argon is 5.0 bar.Predict the final partial pressures of the reactants and products.

Accepted Answer

They all s

Question 18

The lattice enthalpy and the enthalpy of hydration are both always positive.

Accepted Answer

A) True 
 B)False

Question 19

What is the vapor pressure of carbon disulfide at its normal boiling point?

Accepted Answer

The answer of What is the vapor pressure of carbon...

Question 20

The equilibrium constant expression for the reaction
CuSO4(s)$\rightarrow$CuO(s)+ SO3(g)
is K =[CuO(s)][SO3(g)]/[CuSO4(s)].

Accepted Answer

A) True 
 B)False

Write the equilibrium constant for 2NaBr(aq)+Pb(ClO₄)₂(aq) $f$ PbBr₂(s)+ 2NaClO₄(aq).

Given: 2SO₂(g) + O₂(g) $f$ 2SO₃(g) At equilibrium at a certain temperature,The concentrations of SO₃(g),SO₂(g),And O₂(g)Are 0.24 M,0.82 M, And 0.33 M,Respectively. Calculate the value of K_c for this reaction.

If the equilibrium constant for the reaction Ni(s)+ 4CO(g) $f$ Ni(CO)₄(g)is 2.72 at a certain temperature,what is the equilibrium constant for the following reaction at the same temperature? Ni(CO)₄(g) $f$ Ni(s)+ 4CO(g)

The equilibrium constant, K,For the reaction 2HgO(s) $f$ 2Hg(l)+ O₂(g) Is 1.2 * 10^-³⁰.Calculate K for the reaction 1/2O₂(g)+ Hg(l) $f$ HgO(s).

Calculate the number of moles of oxygen that will dissolve in 45 L of water at 20^$\omicron$C if the partial pressure of oxygen is 0.21 atm .Henry's constant for oxygen is 0.0013 mol.L^-¹.atm^-¹.

Which of the following liquids freeze at a lower temperature when pressure is applied?

The phase diagram for CO₂ is given below . The triple point is at 5.1 atm and 217 K. What happens if carbon dioxide at 50C and 25 atm is suddenly brought to 1 atm?

Calculate the vapor pressure of ethyl alcohol, C₂H₅OH(l), At 298 K.The standard free energies of formation of C₂H₅OH(l) And C₂H₅OH(g)Are -174.8 and -168.6 kJ.mol^-¹,Respectively.

Blood, sweat,And tears are about 0.15 M in sodium chloride.Estimate the osmotic pressure of these solutions at 37^$\omicron$C.The gas constant is 0.0821 L.atm.mol^-¹.K^-¹.

For CaCl₂, the absolute value of the enthalpy of hydration is larger than the lattice enthalpy.This means that for CaCl₂

For the reaction 2CaSO₄(s) $f$ 2CaO(s)+ 2SO₂(g)+ O₂(g) K = 0.032 at 700 K.What is the total pressure starting from pure CaSO₄(s)?

the van't Hoff i of HBr,HCl,and HF should all be the same?

Which of the following has the lowest freezing point?

If $\Delta$ G^$\omicron$ = 27.1 kJ at 25^$\omicron$C for the reactionCH₃COOH(aq)+ H₂O(l) $f$ CH₃COO^-(aq)+ H₃O⁺(aq)What is K_a for this reaction at 298 K?

At 25?C, K = 6.9 * 10⁵ for the reaction N₂(g)+ 3H₂(g) $f$ 2NH₃(g) Calculate K_c at 25?C for this reaction.

The lattice enthalpy and the enthalpy of hydration are both always positive.

What is the vapor pressure of carbon disulfide at its normal boiling point?

The equilibrium constant expression for the reaction CuSO₄(s) $\rightarrow$ CuO(s)+ SO₃(g) is K =[CuO(s)][SO₃(g)]/[CuSO₄(s)].

Atoms

Molecules

States of Matter

Thermodynamics

Reactions

Kinetics

The Main-Group Elements

The D-Block Elements

Nuclear Chemistry

Organic Chemistry

Filters

Exam 5: Equilibrium

Write the equilibrium constant for 2NaBr(aq)+Pb(ClO4)2(aq) fff PbBr2(s)+ 2NaClO4(aq).

Given: 2SO2(g) + O2(g) fff 2SO3(g) At equilibrium at a certain temperature,The concentrations of SO3(g),SO2(g),And O2(g)Are 0.24 M,0.82 M, And 0.33 M,Respectively. Calculate the value of Kc for this reaction.

If the equilibrium constant for the reaction Ni(s)+ 4CO(g) fff Ni(CO)4(g)is 2.72 at a certain temperature,what is the equilibrium constant for the following reaction at the same temperature? Ni(CO)4(g) fff Ni(s)+ 4CO(g)

The equilibrium constant, K,For the reaction 2HgO(s) fff 2Hg(l)+ O2(g) Is 1.2 * 10-30.Calculate K for the reaction 1/2O2(g)+ Hg(l) fff HgO(s).

Calculate the number of moles of oxygen that will dissolve in 45 L of water at 20 ο\omicronο C if the partial pressure of oxygen is 0.21 atm .Henry's constant for oxygen is 0.0013 mol.L-1.atm-1.

Which of the following liquids freeze at a lower temperature when pressure is applied?

The phase diagram for CO2 is given below . The triple point is at 5.1 atm and 217 K. What happens if carbon dioxide at 50C and 25 atm is suddenly brought to 1 atm?

Calculate the vapor pressure of ethyl alcohol, C2H5OH(l), At 298 K.The standard free energies of formation of C2H5OH(l) And C2H5OH(g)Are -174.8 and -168.6 kJ.mol-1,Respectively.

Blood, sweat,And tears are about 0.15 M in sodium chloride.Estimate the osmotic pressure of these solutions at 37 ο\omicronο C.The gas constant is 0.0821 L.atm.mol-1.K-1.

For CaCl2, the absolute value of the enthalpy of hydration is larger than the lattice enthalpy.This means that for CaCl2

For the reaction 2CaSO4(s) fff 2CaO(s)+ 2SO2(g)+ O2(g) K = 0.032 at 700 K.What is the total pressure starting from pure CaSO4(s)?

the van't Hoff i of HBr,HCl,and HF should all be the same?

Which of the following has the lowest freezing point?

If Δ\DeltaΔ G ο\omicronο = 27.1 kJ at 25 ο\omicronο C for the reactionCH3COOH(aq)+ H2O(l) fff CH3COO-(aq)+ H3O+(aq)What is Ka for this reaction at 298 K?

For the equilibrium CaCO3(s) fff CaO(s)+ CO2(g), (a)represents the composition at equilibrium at a certain temperature.In (b),a small amount of Ca*CO3(s) has been added (Ca*CO3(s)represents Ca14CO3(s)or labeled calcium carbonate).Draw the composition in (c) at equilibrium and explain your drawing.

At 25?C, K = 6.9 * 105 for the reaction N2(g)+ 3H2(g) fff 2NH3(g) Calculate Kc at 25?C for this reaction.

The lattice enthalpy and the enthalpy of hydration are both always positive.

What is the vapor pressure of carbon disulfide at its normal boiling point?

The equilibrium constant expression for the reaction CuSO4(s) →\rightarrow→ CuO(s)+ SO3(g) is K =[CuO(s)][SO3(g)]/[CuSO4(s)].

Atoms

Molecules

States of Matter

Thermodynamics

Reactions

Kinetics

The Main-Group Elements

The D-Block Elements

Nuclear Chemistry

Organic Chemistry

Filters

Write the equilibrium constant for 2NaBr(aq)+Pb(ClO₄)₂(aq) $f$ PbBr₂(s)+ 2NaClO₄(aq).

Given: 2SO₂(g) + O₂(g) $f$ 2SO₃(g) At equilibrium at a certain temperature,The concentrations of SO₃(g),SO₂(g),And O₂(g)Are 0.24 M,0.82 M, And 0.33 M,Respectively. Calculate the value of K_c for this reaction.

If the equilibrium constant for the reaction Ni(s)+ 4CO(g) $f$ Ni(CO)₄(g)is 2.72 at a certain temperature,what is the equilibrium constant for the following reaction at the same temperature? Ni(CO)₄(g) $f$ Ni(s)+ 4CO(g)

The equilibrium constant, K,For the reaction 2HgO(s) $f$ 2Hg(l)+ O₂(g) Is 1.2 * 10^-³⁰.Calculate K for the reaction 1/2O₂(g)+ Hg(l) $f$ HgO(s).

Calculate the number of moles of oxygen that will dissolve in 45 L of water at 20^$\omicron$C if the partial pressure of oxygen is 0.21 atm .Henry's constant for oxygen is 0.0013 mol.L^-¹.atm^-¹.

The phase diagram for CO₂ is given below . The triple point is at 5.1 atm and 217 K. What happens if carbon dioxide at 50C and 25 atm is suddenly brought to 1 atm?

Calculate the vapor pressure of ethyl alcohol, C₂H₅OH(l), At 298 K.The standard free energies of formation of C₂H₅OH(l) And C₂H₅OH(g)Are -174.8 and -168.6 kJ.mol^-¹,Respectively.

Blood, sweat,And tears are about 0.15 M in sodium chloride.Estimate the osmotic pressure of these solutions at 37^$\omicron$C.The gas constant is 0.0821 L.atm.mol^-¹.K^-¹.

For CaCl₂, the absolute value of the enthalpy of hydration is larger than the lattice enthalpy.This means that for CaCl₂

For the reaction 2CaSO₄(s) $f$ 2CaO(s)+ 2SO₂(g)+ O₂(g) K = 0.032 at 700 K.What is the total pressure starting from pure CaSO₄(s)?

If $\Delta$ G^$\omicron$ = 27.1 kJ at 25^$\omicron$C for the reactionCH₃COOH(aq)+ H₂O(l) $f$ CH₃COO^-(aq)+ H₃O⁺(aq)What is K_a for this reaction at 298 K?

At 25?C, K = 6.9 * 10⁵ for the reaction N₂(g)+ 3H₂(g) $f$ 2NH₃(g) Calculate K_c at 25?C for this reaction.

The equilibrium constant expression for the reaction CuSO₄(s) $\rightarrow$ CuO(s)+ SO₃(g) is K =[CuO(s)][SO₃(g)]/[CuSO₄(s)].