When the 1,7-Diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 Is Treated with Sodium Methoxide and the Reaction
Multiple Choice
When the 1,7-diester CH3O2CCH2CH2CH(CH3) CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid,what kind of compound is the major organic product?
A) an acyclic β-diketone
B) an acyclic β-ketoacid
C) an acyclic β-diester
D) a cyclic β-ketoester
E) a cyclic β-diketone
Correct Answer:
Verified
Correct Answer:
Verified
Q26: Provide a detailed, stepwise mechanism for the
Q54: Which of the labeled hydrogen atoms in
Q56: Provide the major organic product(s)of the reaction
Q57: What materials are needed to prepare the
Q58: A student proposed the following synthesis.Why did
Q60: Give the major product for the following
Q61: Draw the most stable enol of the
Q62: How would you accomplish the following conversion?
Q63: What product is formed in the mixed
Q64: Give the major product for the following